3-phenylpropane-1,1,2,2-tetracarbonitrile structure
|
Common Name | 3-phenylpropane-1,1,2,2-tetracarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 57084-61-4 | Molecular Weight | 220.22900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-phenylpropane-1,1,2,2-tetracarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H8N4 |
|---|---|
| Molecular Weight | 220.22900 |
| Exact Mass | 220.07500 |
| PSA | 95.16000 |
| LogP | 1.92602 |
| InChIKey | APZCJIWKNQJTMI-UHFFFAOYSA-N |
| SMILES | N#CC(C#N)C(C#N)(C#N)Cc1ccccc1 |
|
~%
3-phenylpropane... CAS#:57084-61-4 |
| Literature: Cermenati, Laura; Mella, Mariella; Albini, Angelo Tetrahedron, 1998 , vol. 54, # 11 p. 2575 - 2582 |
|
~%
3-phenylpropane... CAS#:57084-61-4 |
| Literature: Ohashi,M. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1979 , p. 2219 - 2223 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,1,2,2-Propanetetracarbonitrile,3-phenyl |
| 3-Phenylpropan-1,1,2,2-tetracarbonitril |