5-trans Latanoprost (free acid) structure
|
Common Name | 5-trans Latanoprost (free acid) | ||
|---|---|---|---|---|
| CAS Number | 903549-49-5 | Molecular Weight | 390.513 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 609.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C23H34O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 336.2±26.6 °C | |
Use of 5-trans Latanoprost (free acid)5-trans Latanoprost (free acid) is an isomer of latanoprost (free acid) wherein the double bond between carbons 5 and 6 has been changed from cis (Z) to trans (E). |
| Name | 5-trans Latanoprost (free acid) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 609.1±50.0 °C at 760 mmHg |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.513 |
| Flash Point | 336.2±26.6 °C |
| Exact Mass | 390.240631 |
| PSA | 97.99000 |
| LogP | 2.22 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | HNPFPERDNWXAGS-MIDWJBHHSA-N |
| SMILES | O=C(O)CCCC=CCC1C(O)CC(O)C1CCC(O)CCc1ccccc1 |
| (5E)-7-{(1R,2R,3R,5S)-3,5-Dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl}-5-heptenoic acid |
| 5-Heptenoic acid, 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]-, (5E)- |