dimethyl 2-(1,1-dioxothietan-3-ylidene)propanedioate structure
|
Common Name | dimethyl 2-(1,1-dioxothietan-3-ylidene)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 90344-91-5 | Molecular Weight | 234.22600 | |
| Density | 1.469g/cm3 | Boiling Point | 371.2ºC at 760 mmHg | |
| Molecular Formula | C8H10O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.3ºC | |
| Name | dimethyl 2-(1,1-dioxothietan-3-ylidene)propanedioate |
|---|
| Density | 1.469g/cm3 |
|---|---|
| Boiling Point | 371.2ºC at 760 mmHg |
| Molecular Formula | C8H10O6S |
| Molecular Weight | 234.22600 |
| Flash Point | 178.3ºC |
| Exact Mass | 234.02000 |
| PSA | 95.12000 |
| LogP | 0.13820 |
| Index of Refraction | 1.527 |
| InChIKey | JIJHQLXARXABKH-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(=O)OC)=C1CS(=O)(=O)C1 |
|
~%
dimethyl 2-(1,1... CAS#:90344-91-5 |
| Literature: Sedergran, Thomas C.; Yokoyama, Masataka; Dittmer, Donald C. Journal of Organic Chemistry, 1984 , vol. 49, # 13 p. 2408 - 2412 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |