s,s'-methylenebis(n,n-diisobutyldithiocarbamate) structure
|
Common Name | s,s'-methylenebis(n,n-diisobutyldithiocarbamate) | ||
|---|---|---|---|---|
| CAS Number | 90276-58-7 | Molecular Weight | 422.77800 | |
| Density | 1.067g/cm3 | Boiling Point | 471.6ºC at 760 mmHg | |
| Molecular Formula | C19H38N2S4 | Melting Point | 71-73ºC | |
| MSDS | USA | Flash Point | 239ºC | |
| Name | bis(2-methylpropyl)carbamothioylsulfanylmethyl N,N-bis(2-methylpropyl)carbamodithioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.067g/cm3 |
|---|---|
| Boiling Point | 471.6ºC at 760 mmHg |
| Melting Point | 71-73ºC |
| Molecular Formula | C19H38N2S4 |
| Molecular Weight | 422.77800 |
| Flash Point | 239ºC |
| Exact Mass | 422.19200 |
| PSA | 121.26000 |
| LogP | 6.20810 |
| Index of Refraction | 1.559 |
| InChIKey | ZHJPGLVVCSNIEG-UHFFFAOYSA-N |
| SMILES | CC(C)CN(CC(C)C)C(=S)SCSC(=S)N(CC(C)C)CC(C)C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 22-24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~61%
s,s'-methyleneb... CAS#:90276-58-7 |
| Literature: Kamata, Satsuo; Onoyama, Kazuhiro Chemistry Letters, 1991 , # 4 p. 653 - 656 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Simultaneous determination of Zn (II), Cu (II), Cd (II) and Pb (II) in soil samples employing an array of potentiometric sensors and an artificial neural network model. Wilson D, et.al.
Electroanalysis 24 (12) , 2249-2256, (2012)
|
|
|
S. Kamata, K. Onoyama
Anal. Chem. 63 , 1995, (1991)
|
| S,S methylenebis(diisobutyldithiocarbamate) |
| S,S inverted exclamation marka-Methylenebis(N,N-diisobutyldithiocarbamate |
| methylene bis(diisobutyldithiocarbamate) |
| S,S'-Methylenebis(N,N-diisobutyldithiocarbamate |
| MBDiBDTC |
| Lead ionophore II |