2,4,7,9-Tetramethyl-5-decyne-4,7-diol ethoxylate structure
|
Common Name | 2,4,7,9-Tetramethyl-5-decyne-4,7-diol ethoxylate | ||
|---|---|---|---|---|
| CAS Number | 9014-85-1 | Molecular Weight | 288.42300 | |
| Density | 0.982 g/mL at 25ºC | Boiling Point | >121ºC(lit.) | |
| Molecular Formula | C16H32O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 113ºC | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | ethane-1,2-diol,2,4,7,9-tetramethyldec-5-yne-4,7-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.982 g/mL at 25ºC |
|---|---|
| Boiling Point | >121ºC(lit.) |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.42300 |
| Flash Point | 113ºC |
| Exact Mass | 288.23000 |
| PSA | 80.92000 |
| LogP | 1.55500 |
| Index of Refraction | n20/D 1.465 |
| InChIKey | SUHUKEQAOUOUJO-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C)(O)C#CC(C)(O)CC(C)C.OCCO |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H315-H318-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| MFCD00678776 |
| 2,4,7,9-Tetramethyl-5-decyne-4,7-diol ethoxylate |