Boc-Ala-Ala-Gly-pNA
Modify Date: 2025-08-25 21:59:33
Boc-Ala-Ala-Gly-pNA structure
|
Common Name | Boc-Ala-Ala-Gly-pNA | ||
|---|---|---|---|---|
| CAS Number | 90037-94-8 | Molecular Weight | 437.45 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H27N5O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Boc-Ala-Ala-Gly-pNABoc-AAG-pNA is a glycine endopeptidase substrate. Boc-AAG-pNA can be used to test the amidase activity glycine endopeptidase[1]. |
| Name | Boc-Ala-Ala-Gly-pNA |
|---|
| Description | Boc-AAG-pNA is a glycine endopeptidase substrate. Boc-AAG-pNA can be used to test the amidase activity glycine endopeptidase[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C19H27N5O7 |
|---|---|
| Molecular Weight | 437.45 |
| Exact Mass | 437.19100 |
| PSA | 171.45000 |
| LogP | 2.83630 |
| InChIKey | YODBYCPAGJDVOM-RYUDHWBXSA-N |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)NC(C)C(=O)NCC(=O)Nc1ccc([N+](=O)[O-])cc1 |