1,1,1-trifluoro-3-(3-methylphenyl)propan-2-one structure
|
Common Name | 1,1,1-trifluoro-3-(3-methylphenyl)propan-2-one | ||
|---|---|---|---|---|
| CAS Number | 898787-61-6 | Molecular Weight | 202.17300 | |
| Density | 1.199g/cm3 | Boiling Point | 207.2ºC at 760 mmHg | |
| Molecular Formula | C10H9F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 93ºC | |
| Name | 1,1,1-trifluoro-3-(3-methylphenyl)propan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.199g/cm3 |
|---|---|
| Boiling Point | 207.2ºC at 760 mmHg |
| Molecular Formula | C10H9F3O |
| Molecular Weight | 202.17300 |
| Flash Point | 93ºC |
| Exact Mass | 202.06100 |
| PSA | 17.07000 |
| LogP | 2.66890 |
| Index of Refraction | 1.455 |
| InChIKey | CXGINHIVNBDAKL-UHFFFAOYSA-N |
| SMILES | Cc1cccc(CC(=O)C(F)(F)F)c1 |
|
~%
1,1,1-trifluoro... CAS#:898787-61-6 |
| Literature: Usui, Satoshi; Tsuboya, Shoko; Umezawa, Yukthiro; Hazama, Ken; Okamura, Mutsuo Bulletin of the Chemical Society of Japan, 2009 , vol. 82, # 2 p. 254 - 260 |
| 3-(3-methylphenyl)-1,1,1-trifluoro-2-propanone |