Methyl 5-bromo-1H-indazole-7-carboxylate structure
|
Common Name | Methyl 5-bromo-1H-indazole-7-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 898747-24-5 | Molecular Weight | 255.068 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 395.9±22.0 °C at 760 mmHg | |
| Molecular Formula | C9H7BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.2±22.3 °C | |
| Name | Methyl 5-bromo-1H-indazole-7-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 395.9±22.0 °C at 760 mmHg |
| Molecular Formula | C9H7BrN2O2 |
| Molecular Weight | 255.068 |
| Flash Point | 193.2±22.3 °C |
| Exact Mass | 253.969086 |
| PSA | 54.98000 |
| LogP | 2.48 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.676 |
| InChIKey | QQXHHJBRURQNLO-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(Br)cc2cn[nH]c12 |
| Hazard Codes | T+ |
|---|---|
| RIDADR | 2811.0 |
| HS Code | 2933990090 |
|
~%
Methyl 5-bromo-... CAS#:898747-24-5 |
| Literature: WO2008/65508 A1, ; Page/Page column 29-30 ; |
|
~%
Methyl 5-bromo-... CAS#:898747-24-5 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 22, # 3 p. 1156 - 1162 |
|
~%
Methyl 5-bromo-... CAS#:898747-24-5 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 22, # 3 p. 1156 - 1162 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indazole-7-carboxylic acid, 5-bromo-, methyl ester |
| Methyl 5-bromo-1H-indazole-7-carboxylate |