1-(4-methoxyphenyl)-2-(2-phenylethylsulfanyl)ethanone structure
|
Common Name | 1-(4-methoxyphenyl)-2-(2-phenylethylsulfanyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 89805-66-3 | Molecular Weight | 286.38900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-methoxyphenyl)-2-(2-phenylethylsulfanyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H18O2S |
|---|---|
| Molecular Weight | 286.38900 |
| Exact Mass | 286.10300 |
| PSA | 51.60000 |
| LogP | 3.85380 |
| InChIKey | MWEZGFZKYFTQCD-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CSCCc2ccccc2)cc1 |
|
~89%
1-(4-methoxyphe... CAS#:89805-66-3 |
| Literature: Kataoka, Tadashi; Tomoto, Akihiko; Shimizu, Hiroshi; Hori, Mikio Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 12 p. 2913 - 2920 |
| p-methoxyphenacyl phenethyl sulphide |