9H-Purine-9-ethanol,6-amino-a-[(2-propen-1-yloxy)methyl]- structure
|
Common Name | 9H-Purine-9-ethanol,6-amino-a-[(2-propen-1-yloxy)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 89760-74-7 | Molecular Weight | 249.26900 | |
| Density | 1.4g/cm3 | Boiling Point | 505.5ºC at 760 mmHg | |
| Molecular Formula | C11H15N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.5ºC | |
| Name | 1-(6-aminopurin-9-yl)-3-prop-2-enoxypropan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 505.5ºC at 760 mmHg |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.26900 |
| Flash Point | 259.5ºC |
| Exact Mass | 249.12300 |
| PSA | 99.08000 |
| LogP | 0.55320 |
| Index of Refraction | 1.656 |
| InChIKey | ZVZZSRXLVAABGA-UHFFFAOYSA-N |
| SMILES | C=CCOCC(O)Cn1cnc2c(N)ncnc21 |
|
~38%
9H-Purine-9-eth... CAS#:89760-74-7 |
| Literature: Roveri; Cavrini; Gatti; et al. European Journal of Medicinal Chemistry, 1983 , vol. 18, # 6 p. 555 - 557 |
|
~%
9H-Purine-9-eth... CAS#:89760-74-7 |
| Literature: Ozerov; Novikov Chemistry of Heterocyclic Compounds, 1996 , vol. 32, # 6 p. 712 - 715 |
| 9-<2-hydroxy-3-allyloxy-propyl>adenine |