3-chloro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)propanamide structure
|
Common Name | 3-chloro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)propanamide | ||
|---|---|---|---|---|
| CAS Number | 89757-60-8 | Molecular Weight | 251.66900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-chloro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)propanamide |
|---|
| Molecular Formula | C11H10ClN3O2 |
|---|---|
| Molecular Weight | 251.66900 |
| Exact Mass | 251.04600 |
| PSA | 71.51000 |
| LogP | 2.95350 |
| InChIKey | ABVDTCCFWKONEX-UHFFFAOYSA-N |
| SMILES | O=C(CCCl)Nc1nnc(-c2ccccc2)o1 |
|
~65%
3-chloro-N-(5-p... CAS#:89757-60-8 |
| Literature: Saxena, V. K.; Singh, A. R.; Agarwal, R. K.; Mehra, S. C. Journal of the Indian Chemical Society, 1983 , vol. 60, p. 575 - 577 |