5-(3-methoxyphenyl)-2-methylpenta-2,4-dienoic acid structure
|
Common Name | 5-(3-methoxyphenyl)-2-methylpenta-2,4-dienoic acid | ||
|---|---|---|---|---|
| CAS Number | 89650-03-3 | Molecular Weight | 218.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(3-methoxyphenyl)-2-methylpenta-2,4-dienoic acid |
|---|
| Molecular Formula | C13H14O3 |
|---|---|
| Molecular Weight | 218.24800 |
| Exact Mass | 218.09400 |
| PSA | 46.53000 |
| LogP | 2.73930 |
| InChIKey | MUMFCOINGVLYQJ-UHFFFAOYSA-N |
| SMILES | COc1cccc(C=CC=C(C)C(=O)O)c1 |
|
~%
5-(3-methoxyphe... CAS#:89650-03-3 |
| Literature: Bhattacharya, Sudin; Mandal, Asok N.; Chaudhuri, Swadesh R. Ray; Chatterjee, Amareshwar Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 1 p. 5 - 13 |
|
~%
5-(3-methoxyphe... CAS#:89650-03-3 |
| Literature: Bhattacharya, Sudin; Mandal, Asok N.; Chaudhuri, Swadesh R. Ray; Chatterjee, Amareshwar Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 1 p. 5 - 13 |