4-[(4-pyrrolidin-1-ylphenyl)diazenyl]benzonitrile structure
|
Common Name | 4-[(4-pyrrolidin-1-ylphenyl)diazenyl]benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 89505-24-8 | Molecular Weight | 276.33600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(4-pyrrolidin-1-ylphenyl)diazenyl]benzonitrile |
|---|
| Molecular Formula | C17H16N4 |
|---|---|
| Molecular Weight | 276.33600 |
| Exact Mass | 276.13700 |
| PSA | 51.75000 |
| LogP | 4.63888 |
| InChIKey | DRAXZQRLLVCNEK-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(N=Nc2ccc(N3CCCC3)cc2)cc1 |
|
~%
4-[(4-pyrrolidi... CAS#:89505-24-8 |
| Literature: Hallas, Geoffrey; Marsden, Richard; Hepworth, John D.; Mason, Donald Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1984 , # 1 p. 149 - 154 |
|
~%
4-[(4-pyrrolidi... CAS#:89505-24-8 |
| Literature: Hallas, Geoffrey; Marsden, Richard; Hepworth, John D.; Mason, Donald Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1984 , # 1 p. 149 - 154 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |