5-nitro-2-[(4-pyrrolidin-1-ylphenyl)diazenyl]benzonitrile structure
|
Common Name | 5-nitro-2-[(4-pyrrolidin-1-ylphenyl)diazenyl]benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 89505-26-0 | Molecular Weight | 321.33300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-nitro-2-[(4-pyrrolidin-1-ylphenyl)diazenyl]benzonitrile |
|---|
| Molecular Formula | C17H15N5O2 |
|---|---|
| Molecular Weight | 321.33300 |
| Exact Mass | 321.12300 |
| PSA | 97.57000 |
| LogP | 5.07028 |
| InChIKey | BPFFEWPDKOSLHS-UHFFFAOYSA-N |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1N=Nc1ccc(N2CCCC2)cc1 |
|
~%
5-nitro-2-[(4-p... CAS#:89505-26-0 |
| Literature: Hallas, Geoffrey; Marsden, Richard; Hepworth, John D.; Mason, Donald Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1984 , # 1 p. 149 - 154 |
|
~%
5-nitro-2-[(4-p... CAS#:89505-26-0 |
| Literature: Hallas, Geoffrey; Marsden, Richard; Hepworth, John D.; Mason, Donald Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1984 , # 1 p. 149 - 154 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |