boc-d-cyclopropylalanine-dcha structure
|
Common Name | boc-d-cyclopropylalanine-dcha | ||
|---|---|---|---|---|
| CAS Number | 89483-09-0 | Molecular Weight | 410.591 | |
| Density | N/A | Boiling Point | 377.2ºC at 760 mmHg | |
| Molecular Formula | C23H42N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.9ºC | |
| Name | (R)-2-((tert-Butoxycarbonyl)(cyclopropyl)amino)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 377.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C23H42N2O4 |
| Molecular Weight | 410.591 |
| Flash Point | 181.9ºC |
| Exact Mass | 410.314453 |
| PSA | 87.66000 |
| LogP | 5.78760 |
| InChIKey | MQINYDUVLDJIAC-NIFFTEIASA-N |
| SMILES | C1CCC(NC2CCCCC2)CC1.CC(C)(C)OC(=O)NC(CC1CC1)C(=O)O |
| Storage condition | -15°C |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2922509090 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Cyclopropanepropanoic acid, α-[[(1,1-dimethylethoxy)carbonyl]amino]-, compd. with N-cyclohexylcyclohexanamine (1:1) |
| 3-Cyclopropyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}alanine - N-cyclohexylcyclohexanamine (1:1) |
| 3-Cyclopropyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-alanine - N-cyclohexylcyclohexanamine (1:1) |
| Cyclopropanepropanoic acid, α-[[(1,1-dimethylethoxy)carbonyl]amino]-, (αR)-, compd. with N-cyclohexylcyclohexanamine (1:1) |
| boc-d-cyclopropylalanine-dcha |