4-(2,5-dimethoxy-phenyl)-3-oxo-butyric acid ethyl ester
Modify Date: 2025-08-26 18:36:13
4-(2,5-dimethoxy-phenyl)-3-oxo-butyric acid ethyl ester structure
|
Common Name | 4-(2,5-dimethoxy-phenyl)-3-oxo-butyric acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 894802-86-9 | Molecular Weight | 266.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2,5-dimethoxy-phenyl)-3-oxo-butyric acid ethyl ester |
|---|
| Molecular Formula | C14H18O5 |
|---|---|
| Molecular Weight | 266.29000 |
| Exact Mass | 266.11500 |
| PSA | 61.83000 |
| LogP | 1.76860 |
| InChIKey | ZFTPEUIWAMALGS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)Cc1cc(OC)ccc1OC |
|
~94%
4-(2,5-dimethox... CAS#:894802-86-9 |
| Literature: Terai, Takuya; Kikuchi, Kazuya; Iwasawa, Shin-Ya; Kawabe, Takao; Hirata, Yasunobu; Urano, Yasuteru; Nagano, Tetsuo Journal of the American Chemical Society, 2006 , vol. 128, # 21 p. 6938 - 6946 |
|
~%
4-(2,5-dimethox... CAS#:894802-86-9 |
| Literature: Terai, Takuya; Kikuchi, Kazuya; Iwasawa, Shin-Ya; Kawabe, Takao; Hirata, Yasunobu; Urano, Yasuteru; Nagano, Tetsuo Journal of the American Chemical Society, 2006 , vol. 128, # 21 p. 6938 - 6946 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |