4-Methyl-N-(4-nitrophenyl)-N-phenylaniline
Modify Date: 2025-09-15 18:41:14
4-Methyl-N-(4-nitrophenyl)-N-phenylaniline structure
|
Common Name | 4-Methyl-N-(4-nitrophenyl)-N-phenylaniline | ||
|---|---|---|---|---|
| CAS Number | 894430-73-0 | Molecular Weight | 304.342 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 470.1±38.0 °C at 760 mmHg | |
| Molecular Formula | C19H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.1±26.8 °C | |
| Name | 4-methyl-N-(4-nitrophenyl)-N-phenylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 470.1±38.0 °C at 760 mmHg |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.342 |
| Flash Point | 238.1±26.8 °C |
| Exact Mass | 304.121185 |
| PSA | 49.06000 |
| LogP | 6.48 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.657 |
| InChIKey | LUNSHOIFFSFPAG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N(c2ccccc2)c2ccc([N+](=O)[O-])cc2)cc1 |
| HS Code | 2921440000 |
|---|
| HS Code | 2921440000 |
|---|---|
| Summary | 2921440000. diphenylamine and its derivatives; salts thereof. VAT:17.0%. Tax rebate rate:17.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzenamine, 4-methyl-N-(4-nitrophenyl)-N-phenyl- |
| 4-Methyl-N-(4-nitrophenyl)-N-phenylbenzenamine |
| 4-nitro-4'-methyltriphenylamine |
| 4-Methyl-N-(4-nitrophenyl)-N-phenylaniline |