4-METHYL-N-(4-NITROPHENYL)-N-(P-TOLYL)ANILINE structure
|
Common Name | 4-METHYL-N-(4-NITROPHENYL)-N-(P-TOLYL)ANILINE | ||
|---|---|---|---|---|
| CAS Number | 20440-92-0 | Molecular Weight | 318.369 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 483.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H18N2O2 | Melting Point | 162-163ºC | |
| MSDS | N/A | Flash Point | 246.4±28.7 °C | |
| Name | 4-methyl-N-(4-methylphenyl)-N-(4-nitrophenyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 483.8±45.0 °C at 760 mmHg |
| Melting Point | 162-163ºC |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.369 |
| Flash Point | 246.4±28.7 °C |
| Exact Mass | 318.136841 |
| PSA | 49.06000 |
| LogP | 6.94 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.647 |
| InChIKey | QQPWXACSUPBIDW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc([N+](=O)[O-])cc2)cc1 |
| HS Code | 2921440000 |
|---|
|
~21%
4-METHYL-N-(4-N... CAS#:20440-92-0 |
| Literature: Synlett, , # 8 art. no. W00811ST, p. 1137 - 1142 |
|
~67%
4-METHYL-N-(4-N... CAS#:20440-92-0 |
| Literature: Tanino, Takahiro; Yoshikawa, Satoru; Ujike, Toshiki; Nagahama, Daisuke; Moriwaki, Kazuyuki; Takahashi, Toru; Kotani, Yoshiko; Nakano, Hideyuki; Shirota, Yasuhiko Journal of Materials Chemistry, 2007 , vol. 17, # 47 p. 4953 - 4963 |
|
~21%
4-METHYL-N-(4-N... CAS#:20440-92-0 |
| Literature: Synlett, , # 8 art. no. W00811ST, p. 1137 - 1142 |
| HS Code | 2921440000 |
|---|---|
| Summary | 2921440000. diphenylamine and its derivatives; salts thereof. VAT:17.0%. Tax rebate rate:17.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (4-nitro-phenyl)-di-p-tolyl-amine |
| 4-nitro-N,N-bis(4-methylphenyl)aniline |
| 4-Nitro-N,N-bis(4-methylphenyl)benzenamine |
| (4-Nitro-phenyl)-di-p-tolyl-amin |
| 4-Methyl-N-(4-methylphenyl)-N-(4-nitrophenyl)aniline |
| 4,4'-Dimethyl-4''-nitrophenylamin |
| 4-Methyl-N-(4-nitrophenyl)-N-(p-tolyl)aniline |
| Benzenamine, 4-methyl-N-(4-methylphenyl)-N-(4-nitrophenyl)- |