(4-acetyl-3-methoxyphenyl)methyl acetate structure
|
Common Name | (4-acetyl-3-methoxyphenyl)methyl acetate | ||
|---|---|---|---|---|
| CAS Number | 89414-48-2 | Molecular Weight | 222.23700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-acetyl-3-methoxyphenyl)methyl acetate |
|---|
| Molecular Formula | C12H14O4 |
|---|---|
| Molecular Weight | 222.23700 |
| Exact Mass | 222.08900 |
| PSA | 52.60000 |
| LogP | 1.96090 |
| InChIKey | ZIUNKSMTMNCVQL-UHFFFAOYSA-N |
| SMILES | COc1cc(COC(C)=O)ccc1C(C)=O |
|
~0%
(4-acetyl-3-met... CAS#:89414-48-2 |
| Literature: Sternberg; Vollhardt Journal of Organic Chemistry, 1984 , vol. 49, # 9 p. 1574 - 1583 |
|
~%
(4-acetyl-3-met... CAS#:89414-48-2 |
| Literature: Sternberg; Vollhardt Journal of Organic Chemistry, 1984 , vol. 49, # 9 p. 1574 - 1583 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |