trimethyl-[2-[(1,1,3,3-tetraoxo-1λ6,3λ6-benzodithiol-2-yl)oxy]ethyl]silane structure
|
Common Name | trimethyl-[2-[(1,1,3,3-tetraoxo-1λ6,3λ6-benzodithiol-2-yl)oxy]ethyl]silane | ||
|---|---|---|---|---|
| CAS Number | 89414-27-7 | Molecular Weight | 334.48400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18O5S2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-[2-[(1,1,3,3-tetraoxo-1λ6,3λ6-benzodithiol-2-yl)oxy]ethyl]silane |
|---|
| Molecular Formula | C12H18O5S2Si |
|---|---|
| Molecular Weight | 334.48400 |
| Exact Mass | 334.03600 |
| PSA | 94.27000 |
| LogP | 4.04760 |
| InChIKey | KZGJGZVZPBEQDU-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CCOC1S(=O)(=O)c2ccccc2S1(=O)=O |
|
~62%
trimethyl-[2-[(... CAS#:89414-27-7 |
| Literature: Trost, Barry M.; Quayle, Peter Journal of the American Chemical Society, 1984 , vol. 106, # 8 p. 2469 - 2471 |
|
~%
trimethyl-[2-[(... CAS#:89414-27-7 |
| Literature: Trost, Barry M.; Quayle, Peter Journal of the American Chemical Society, 1984 , vol. 106, # 8 p. 2469 - 2471 |
|
~%
trimethyl-[2-[(... CAS#:89414-27-7 |
| Literature: Trost, Barry M.; Quayle, Peter Journal of the American Chemical Society, 1984 , vol. 106, # 8 p. 2469 - 2471 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |