2-chloro-N-(cyclohexylcarbamothioyl)pyridine-3-carboxamide structure
|
Common Name | 2-chloro-N-(cyclohexylcarbamothioyl)pyridine-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 89374-24-3 | Molecular Weight | 297.80400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16ClN3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-N-(cyclohexylcarbamothioyl)pyridine-3-carboxamide |
|---|
| Molecular Formula | C13H16ClN3OS |
|---|---|
| Molecular Weight | 297.80400 |
| Exact Mass | 297.07000 |
| PSA | 96.64000 |
| LogP | 3.65810 |
| InChIKey | ONRSRZXSWBTYBJ-UHFFFAOYSA-N |
| SMILES | O=C(NC(=S)NC1CCCCC1)c1cccnc1Cl |
|
~20%
2-chloro-N-(cyc... CAS#:89374-24-3 |
| Literature: Koscik; Kristian; Gonda; Dandarova Collection of Czechoslovak Chemical Communications, 1983 , vol. 48, # 11 p. 3315 - 3328 |
|
~%
2-chloro-N-(cyc... CAS#:89374-24-3 |
| Literature: Koscik; Kristian; Gonda; Dandarova Collection of Czechoslovak Chemical Communications, 1983 , vol. 48, # 11 p. 3315 - 3328 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |