N-(diethylcarbamothioyl)-4-methoxybenzamide structure
|
Common Name | N-(diethylcarbamothioyl)-4-methoxybenzamide | ||
|---|---|---|---|---|
| CAS Number | 89314-39-6 | Molecular Weight | 266.35900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(diethylcarbamothioyl)-4-methoxybenzamide |
|---|
| Molecular Formula | C13H18N2O2S |
|---|---|
| Molecular Weight | 266.35900 |
| Exact Mass | 266.10900 |
| PSA | 77.15000 |
| LogP | 2.62650 |
| InChIKey | MWDUNPOJYKWHHG-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=S)NC(=O)c1ccc(OC)cc1 |
|
~%
N-(diethylcarba... CAS#:89314-39-6 |
| Literature: Sabbaghan, Maryam; Alidoust, Mostafa; Hossaini, Zinatossadat Combinatorial Chemistry and High Throughput Screening, 2011 , vol. 14, # 9 p. 824 - 828 |
|
~%
N-(diethylcarba... CAS#:89314-39-6 |
| Literature: Sabbaghan, Maryam; Alidoust, Mostafa; Hossaini, Zinatossadat Combinatorial Chemistry and High Throughput Screening, 2011 , vol. 14, # 9 p. 824 - 828 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |