1,3-dimethyl-6-(1-methylindol-3-yl)pyrimidine-2,4-dione structure
|
Common Name | 1,3-dimethyl-6-(1-methylindol-3-yl)pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 89246-33-3 | Molecular Weight | 269.29900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-dimethyl-6-(1-methylindol-3-yl)pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H15N3O2 |
|---|---|
| Molecular Weight | 269.29900 |
| Exact Mass | 269.11600 |
| PSA | 48.93000 |
| LogP | 1.24270 |
| InChIKey | HVKZZLPYZRINBC-UHFFFAOYSA-N |
| SMILES | Cn1c(-c2cn(C)c3ccccc23)cc(=O)n(C)c1=O |
|
~86%
1,3-dimethyl-6-... CAS#:89246-33-3 |
| Literature: Sako; Hirota; Maki Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 10 p. 3496 - 3502 |
|
~%
1,3-dimethyl-6-... CAS#:89246-33-3 |
| Literature: Sako; Hirota; Maki Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 10 p. 3496 - 3502 |
|
~%
1,3-dimethyl-6-... CAS#:89246-33-3 |
| Literature: Sako; Hirota; Maki Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 10 p. 3496 - 3502 |
| 2,4(1H,3H)-Pyrimidinedione,1,3-dimethyl-6-(1-methyl-1H-indol-3-yl) |
| 1,3-dimethyl-6-(1-methylindol-3-yl)uracil |