5-bromo-3-methyl-6-phenylsulfanyl-1H-pyrimidine-2,4-dione structure
|
Common Name | 5-bromo-3-methyl-6-phenylsulfanyl-1H-pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 81077-92-1 | Molecular Weight | 313.17000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9BrN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-bromo-3-methyl-6-phenylsulfanyl-1H-pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H9BrN2O2S |
|---|---|
| Molecular Weight | 313.17000 |
| Exact Mass | 311.95700 |
| PSA | 80.42000 |
| LogP | 2.39960 |
| InChIKey | XBKJCNDBEAPTTK-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)[nH]c(Sc2ccccc2)c(Br)c1=O |
|
~%
5-bromo-3-methy... CAS#:81077-92-1 |
| Literature: Sako, Magiochi; Suzuki, Mikio; Tanabe, Miyuki; Maki, Yoshifumi Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 3114 - 3117 |
| 2,4(1H,3H)-Pyrimidinedione,5-bromo-3-methyl-6-(phenylthio) |
| 5-bromo-3-methyl-6-phenylthiouracil |