β-D-Ribofuranose analogue 1 structure
|
Common Name | β-D-Ribofuranose analogue 1 | ||
|---|---|---|---|---|
| CAS Number | 89129-10-2 | Molecular Weight | 539.52 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H28F3N3O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of β-D-Ribofuranose analogue 1β-D-Ribofuranose analogue 1 is a nucleoside compound. β-D-Ribofuranose analogue 1 can be used for RNA synthesis[1]. |
| Name | β-D-Ribofuranose analogue 1 |
|---|
| Description | β-D-Ribofuranose analogue 1 is a nucleoside compound. β-D-Ribofuranose analogue 1 can be used for RNA synthesis[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C21H28F3N3O8S |
|---|---|
| Molecular Weight | 539.52 |
| InChIKey | DRDPZVPTYQHFTB-XKVFNRALSA-N |
| SMILES | CC(C)(C)OC(=O)CN(Cc1cn(C2OC(CO)C3OC(C)(C)OC32)c(=S)[nH]c1=O)C(=O)C(F)(F)F |