Odoratisol B
Modify Date: 2025-08-24 22:58:25
Odoratisol B structure
|
Common Name | Odoratisol B | ||
|---|---|---|---|---|
| CAS Number | 891182-94-8 | Molecular Weight | 344.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H24O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Odoratisol BOdoratisol B is a natural product that can be isolated from Machilus odoratissima NEES[1]. |
| Name | Odoratisol B |
|---|
| Description | Odoratisol B is a natural product that can be isolated from Machilus odoratissima NEES[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C20H24O5 |
|---|---|
| Molecular Weight | 344.40 |
| InChIKey | WCFYXOLUODJLKB-IDVZPQIDSA-N |
| SMILES | CC=Cc1ccc(OC(C)C(O)c2ccc(O)c(OC)c2)c(OC)c1 |