Ro 22-8515 structure
|
Common Name | Ro 22-8515 | ||
|---|---|---|---|---|
| CAS Number | 89052-67-5 | Molecular Weight | 343.20700 | |
| Density | 1.46g/cm3 | Boiling Point | 574.4ºC at 760mmHg | |
| Molecular Formula | C18H12Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.2ºC | |
Use of Ro 22-8515Ro 22-8515 is a ligand of Benzodiazepine receptor[1]. |
| Name | 8-chloro-6-(2-chlorophenyl)-2,4-dihydro-1H-pyrrolo[3,4-d][2]benzazepin-3-one |
|---|---|
| Synonym | More Synonyms |
| Description | Ro 22-8515 is a ligand of Benzodiazepine receptor[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 574.4ºC at 760mmHg |
| Molecular Formula | C18H12Cl2N2O |
| Molecular Weight | 343.20700 |
| Flash Point | 301.2ºC |
| Exact Mass | 342.03300 |
| PSA | 44.95000 |
| LogP | 3.43930 |
| Index of Refraction | 1.711 |
| InChIKey | HGIIXNGRZKUQIS-UHFFFAOYSA-N |
| SMILES | O=C1NCC2=C1CN=C(c1ccccc1Cl)c1cc(Cl)ccc12 |
| 8-Chloro-6-(2-chlorophenyl)-1,4-dihydropyrrolo(3,4-D)(2)benzazepin-3-(2H)one |
| Pyrrolo(3,4-d)(2)benzazepin-3(2H)-one,8-chloro-6-(2-chlorophenyl)-1,4-dihydro |
| Ro 22-8515 |