SPDMV
Modify Date: 2025-11-28 19:51:06
SPDMV structure
|
Common Name | SPDMV | ||
|---|---|---|---|---|
| CAS Number | 890409-85-5 | Molecular Weight | 354.44 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SPDMVSPDMV is a glutathione cleavable ADC linker used for the antibody-drug conjugate (ADCs)[1]. |
| Name | SPDMV |
|---|
| Description | SPDMV is a glutathione cleavable ADC linker used for the antibody-drug conjugate (ADCs)[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Daniel Teufel, et al. Bicyclic peptide-toxin conjugates specific for mt1-mmp. WO2017191460A1. |
| Molecular Formula | C15H18N2O4S2 |
|---|---|
| Molecular Weight | 354.44 |
| InChIKey | GOJXFKVHNIGABU-UHFFFAOYSA-N |
| SMILES | CC(C)(CCC(=O)ON1C(=O)CCC1=O)SSc1ccccn1 |