NO2-SPDMV-sulfo
Modify Date: 2025-11-28 15:58:47
NO2-SPDMV-sulfo structure
|
Common Name | NO2-SPDMV-sulfo | ||
|---|---|---|---|---|
| CAS Number | 663599-00-6 | Molecular Weight | 479.51 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17N3O9S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of NO2-SPDMV-sulfoNO2-SPDMV-sulfo is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | NO2-SPDMV-sulfo |
|---|
| Description | NO2-SPDMV-sulfo is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Molecular Formula | C15H17N3O9S3 |
|---|---|
| Molecular Weight | 479.51 |
| InChIKey | IRNRGROVFWZJTL-UHFFFAOYSA-N |
| SMILES | CC(C)(CCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)SSc1ccc([N+](=O)[O-])cn1 |