2,6-Difluoro-4-methoxyphenylacetic acid structure
|
Common Name | 2,6-Difluoro-4-methoxyphenylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 886498-98-2 | Molecular Weight | 202.155 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 269.4±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H8F2O3 | Melting Point | 138-141°C | |
| MSDS | N/A | Flash Point | 116.7±25.9 °C | |
| Name | 2,6-Difluoro-4-methoxyphenylacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 269.4±35.0 °C at 760 mmHg |
| Melting Point | 138-141°C |
| Molecular Formula | C9H8F2O3 |
| Molecular Weight | 202.155 |
| Flash Point | 116.7±25.9 °C |
| Exact Mass | 202.044144 |
| PSA | 46.53000 |
| LogP | 1.66 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.502 |
| InChIKey | KXWRAINJKJTUDG-UHFFFAOYSA-N |
| SMILES | COc1cc(F)c(CC(=O)O)c(F)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
|
~94%
2,6-Difluoro-4-... CAS#:886498-98-2 |
| Literature: Woo, L. W. Lawrence; Wood, Paul M.; Bubert, Christian; Thomas, Mark P.; Purohit, Atul; Potter, Barry V. L. ChemMedChem, 2013 , vol. 8, # 5 p. 779 - 799 |
|
~%
2,6-Difluoro-4-... CAS#:886498-98-2 |
| Literature: WO2011/23989 A1, ; WO 2011/023989 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,6-Difluoro-4-methoxybenzeneacetic acid |
| QV1R BF FF DO1 |
| (2,6-Difluoro-4-methoxyphenyl)acetic acid |
| 2-(2,6-Difluoro-4-methoxyphenyl)acetic acid |
| Benzeneacetic acid, 2,6-difluoro-4-methoxy- |
| 2,6-Difluoro-4-methoxyphenylacetic acid |