3-Fluoro-4-(trifluoromethoxy)benzoic acid
Modify Date: 2025-10-05 07:32:31
3-Fluoro-4-(trifluoromethoxy)benzoic acid structure
|
Common Name | 3-Fluoro-4-(trifluoromethoxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 886498-89-1 | Molecular Weight | 224.10900 | |
| Density | 1.529g/cm3 | Boiling Point | 238ºC at 760 mmHg | |
| Molecular Formula | C8H4F4O3 | Melting Point | 96-97ºC | |
| MSDS | N/A | Flash Point | 97.7ºC | |
| Name | 3-Fluoro-4-(trifluoromethoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.529g/cm3 |
|---|---|
| Boiling Point | 238ºC at 760 mmHg |
| Melting Point | 96-97ºC |
| Molecular Formula | C8H4F4O3 |
| Molecular Weight | 224.10900 |
| Flash Point | 97.7ºC |
| Exact Mass | 224.01000 |
| PSA | 46.53000 |
| LogP | 2.42250 |
| Index of Refraction | 1.462 |
| InChIKey | PIBFTHWKVKHHMA-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(OC(F)(F)F)c(F)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2918990090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:886498-99-3| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| JRD-1733 |
| 3-Fluoro-4-trifluoromethoxy-benzoic acid |