(3-methylphenyl) 2-carbamoyloxy-4-chloro-benzoate
Modify Date: 2025-09-18 16:30:04
(3-methylphenyl) 2-carbamoyloxy-4-chloro-benzoate structure
|
Common Name | (3-methylphenyl) 2-carbamoyloxy-4-chloro-benzoate | ||
|---|---|---|---|---|
| CAS Number | 88599-68-2 | Molecular Weight | 305.71300 | |
| Density | 1.353g/cm3 | Boiling Point | 497.7ºC at 760 mmHg | |
| Molecular Formula | C15H12ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.8ºC | |
| Name | (3-methylphenyl) 2-carbamoyloxy-4-chlorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.353g/cm3 |
|---|---|
| Boiling Point | 497.7ºC at 760 mmHg |
| Molecular Formula | C15H12ClNO4 |
| Molecular Weight | 305.71300 |
| Flash Point | 254.8ºC |
| Exact Mass | 305.04500 |
| PSA | 79.61000 |
| LogP | 3.83890 |
| Index of Refraction | 1.605 |
| InChIKey | QRMOMHYVKXFJIY-UHFFFAOYSA-N |
| SMILES | Cc1cc(OC(=O)c2ccccc2OC(N)=O)ccc1Cl |
| HS Code | 2924299090 |
|---|
|
~%
(3-methylphenyl... CAS#:88599-68-2 |
| Literature: Kamal; Rao; Diwan; Sattur European Journal of Medicinal Chemistry, 1988 , vol. 23, # 5 p. 487 - 489 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (3-METHYLPHENYL) 2-CARBAMOYLOXY-4-CHLORO-BENZOATE |
| Benzoic acid,2-[(aminocarbonyl)oxy]-,4-chloro-3-methylphenyl ester |