(2-methylphenyl) 2-carbamoyloxy-5-chloro-benzoate structure
|
Common Name | (2-methylphenyl) 2-carbamoyloxy-5-chloro-benzoate | ||
|---|---|---|---|---|
| CAS Number | 88599-48-8 | Molecular Weight | 305.71300 | |
| Density | 1.353g/cm3 | Boiling Point | 541.2ºC at 760 mmHg | |
| Molecular Formula | C15H12ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.1ºC | |
| Name | (2-methylphenyl) 2-carbamoyloxy-5-chlorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.353g/cm3 |
|---|---|
| Boiling Point | 541.2ºC at 760 mmHg |
| Molecular Formula | C15H12ClNO4 |
| Molecular Weight | 305.71300 |
| Flash Point | 281.1ºC |
| Exact Mass | 305.04500 |
| PSA | 79.61000 |
| LogP | 3.83890 |
| Index of Refraction | 1.605 |
| InChIKey | TWXVOXHOUYVOKS-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1OC(=O)c1cc(Cl)ccc1OC(N)=O |
| HS Code | 2924299090 |
|---|
|
~%
(2-methylphenyl... CAS#:88599-48-8 |
| Literature: Kamal; Rao; Diwan; Sattur European Journal of Medicinal Chemistry, 1988 , vol. 23, # 5 p. 487 - 489 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (2-METHYLPHENYL) 2-CARBAMOYLOXY-5-CHLORO-BENZOATE |
| Benzoic acid,2-((aminocarbonyl)oxy)-5-chloro-,2-methylphenyl ester |
| 2-Methylphenyl 2-((aminocarbonyl)oxy)-5-chlorobenzoate |