propan-2-yl 2-carbamoyloxy-5-chloro-benzoate
Modify Date: 2025-09-18 12:09:06
propan-2-yl 2-carbamoyloxy-5-chloro-benzoate structure
|
Common Name | propan-2-yl 2-carbamoyloxy-5-chloro-benzoate | ||
|---|---|---|---|---|
| CAS Number | 88599-42-2 | Molecular Weight | 257.67000 | |
| Density | 1.304g/cm3 | Boiling Point | 416.1ºC at 760 mmHg | |
| Molecular Formula | C11H12ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.5ºC | |
| Name | propan-2-yl 2-carbamoyloxy-5-chlorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.304g/cm3 |
|---|---|
| Boiling Point | 416.1ºC at 760 mmHg |
| Molecular Formula | C11H12ClNO4 |
| Molecular Weight | 257.67000 |
| Flash Point | 205.5ºC |
| Exact Mass | 257.04500 |
| PSA | 79.61000 |
| LogP | 2.87650 |
| Index of Refraction | 1.544 |
| InChIKey | BJIUVGLEVZTMHK-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)c1cc(Cl)ccc1OC(N)=O |
| HS Code | 2924299090 |
|---|
|
~%
propan-2-yl 2-c... CAS#:88599-42-2 |
| Literature: Kamal; Rao; Diwan; Sattur European Journal of Medicinal Chemistry, 1988 , vol. 23, # 5 p. 487 - 489 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid,2-((aminocarbonyl)oxy)-5-chloro-,1-methylethyl ester |
| 1-Methylethyl 2-((aminocarbonyl)oxy)-5-chlorobenzoate |
| PROPAN-2-YL 2-CARBAMOYLOXY-5-CHLORO-BENZOATE |