N-[3',6'-Bis(ethylamino)-2',7'-dimethyl-3-oxospiro[1H-isoindole-1,9'-[9H]xanthen]-2(3H)-yl]-N'-phenylthiourea structure
|
Common Name | N-[3',6'-Bis(ethylamino)-2',7'-dimethyl-3-oxospiro[1H-isoindole-1,9'-[9H]xanthen]-2(3H)-yl]-N'-phenylthiourea | ||
|---|---|---|---|---|
| CAS Number | 885481-03-8 | Molecular Weight | 563.71200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H33N5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[3',6'-bis(ethylamino)-2',7'-dimethyl-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]-3-phenylthiourea |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C33H33N5O2S |
|---|---|
| Molecular Weight | 563.71200 |
| Exact Mass | 563.23500 |
| PSA | 116.79000 |
| LogP | 7.61730 |
| InChIKey | LHZILEOAOQHFBN-UHFFFAOYSA-N |
| SMILES | CCNc1cc2c(cc1C)C1(c3cc(C)c(NCC)cc3O2)c2ccccc2C(=O)N1NC(=S)Nc1ccccc1 |
| Hazard Codes | Xi |
|---|
|
~92%
N-[3',6'-Bis(et... CAS#:885481-03-8 |
| Literature: Yang, Young-Keun; Ko, Sung-Kyun; Shin, Injae; Tae, Jinsung Organic and Biomolecular Chemistry, 2009 , vol. 7, # 22 p. 4590 - 4593 |
|
~%
N-[3',6'-Bis(et... CAS#:885481-03-8 |
| Literature: Yang, Young-Keun; Yook, Keun-Jeong; Tae, Jinsung Journal of the American Chemical Society, 2005 , vol. 127, # 48 p. 16760 - 16761 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-[3',6'-Bis(ethylamino)-2',7'-dimethyl-3-oxospiro[1H-isoindole-1,9'-[9H]xanthen]-2(3H)-yl]-N'-phenylthiourea |
| Rhodamine-6G N-Phenyl-thiosemicarbazide |