(4-nitrophenyl) carbonate
Modify Date: 2025-09-09 19:01:31
(4-nitrophenyl) carbonate structure
|
Common Name | (4-nitrophenyl) carbonate | ||
|---|---|---|---|---|
| CAS Number | 88473-88-5 | Molecular Weight | 182.11000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H4NO5- | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-nitrophenyl) carbonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H4NO5- |
|---|---|
| Molecular Weight | 182.11000 |
| Exact Mass | 182.00900 |
| PSA | 95.18000 |
| LogP | 0.84010 |
| InChIKey | LOVPHSMOAVXQIH-UHFFFAOYSA-M |
| SMILES | O=C([O-])Oc1ccc([N+](=O)[O-])cc1 |
|
~74%
(4-nitrophenyl)... CAS#:88473-88-5 |
| Literature: Wisconsin Alumni Research Foundation Patent: US6270957 B1, 2001 ; |
|
~%
(4-nitrophenyl)... CAS#:88473-88-5 |
| Literature: Marlier, John F.; O'Leary, Marion H. Journal of the American Chemical Society, 1990 , vol. 112, # 16 p. 5996 - 5998 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| para-nitrophenyl carbonate |
| p-Nitrophenol carbonate |
| 4-nitrophenyl carbonate |
| pNP carbonate |
| p-nitrophenylcarbonate |