chloromethyl (4-nitrophenyl) carbonate
Modify Date: 2025-08-28 17:02:02
chloromethyl (4-nitrophenyl) carbonate structure
|
Common Name | chloromethyl (4-nitrophenyl) carbonate | ||
|---|---|---|---|---|
| CAS Number | 50780-50-2 | Molecular Weight | 231.59000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | chloromethyl (4-nitrophenyl) carbonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H6ClNO5 |
|---|---|
| Molecular Weight | 231.59000 |
| Exact Mass | 230.99300 |
| PSA | 81.35000 |
| LogP | 2.82970 |
| InChIKey | PDTWCUYBIVJSTL-UHFFFAOYSA-N |
| SMILES | O=C(OCCl)Oc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2920909090 |
|---|
|
~95%
chloromethyl (4... CAS#:50780-50-2 |
| Literature: XenoPort, Inc. Patent: US2006/229361 A1, 2006 ; Location in patent: Page/Page column 36 ; |
|
~%
chloromethyl (4... CAS#:50780-50-2 |
| Literature: The University of Kansas Patent: US5672584 A1, 1997 ; |
CAS#:101623-70-5
CAS#:124068-97-9| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-chloromethoxycarbonyloxy-1-nitrobenzene |
| carbonic acid (chloromethyl ester) (4-nitrophenyl ester) |
| 2-chloromethyl-p-nitrophenyl carbonate |
| chloromethyl p-nitrophenyl carbonate |
| chloromethyl-4-nitrophenyl carbonate |
| Carbonic acid,chloromethyl 4-nitrophenyl ester |