2-(3-Oxo-2-phenylisoindolin-1-yl)aceticacid structure
|
Common Name | 2-(3-Oxo-2-phenylisoindolin-1-yl)aceticacid | ||
|---|---|---|---|---|
| CAS Number | 88460-51-9 | Molecular Weight | 267.27900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-oxo-2-phenyl-1H-isoindol-1-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H13NO3 |
|---|---|
| Molecular Weight | 267.27900 |
| Exact Mass | 267.09000 |
| PSA | 57.61000 |
| LogP | 2.92780 |
| InChIKey | IAMAZOQKJCFDLZ-UHFFFAOYSA-N |
| SMILES | O=C(O)CC1c2ccccc2C(=O)N1c1ccccc1 |
|
~%
2-(3-Oxo-2-phen... CAS#:88460-51-9 |
| Literature: Ishihara; Kiyota; Goto Chemical and Pharmaceutical Bulletin, 1990 , vol. 38, # 11 p. 3024 - 3030 |
|
~%
2-(3-Oxo-2-phen... CAS#:88460-51-9 |
| Literature: Ishihara; Kiyota; Goto Chemical and Pharmaceutical Bulletin, 1990 , vol. 38, # 11 p. 3024 - 3030 |
|
~%
2-(3-Oxo-2-phen... CAS#:88460-51-9 |
| Literature: Ishihara; Kiyota; Goto Chemical and Pharmaceutical Bulletin, 1990 , vol. 38, # 11 p. 3024 - 3030 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1H-Isoindole-1-acetic acid,2,3-dihydro-3-oxo-2-phenyl |
| 2,3-Dihydro-3-oxo-2-phenyl-1H-isoindole-1-acetic Acid |
| 3-Oxo-2-phenylisoindoline-acetic acid |
| 3-oxo-2-phenylisoindoline-1-acetic acid |