N-Methyl-4-[(4-methylhomopiperazin-1-yl)methyl]benzylamine structure
|
Common Name | N-Methyl-4-[(4-methylhomopiperazin-1-yl)methyl]benzylamine | ||
|---|---|---|---|---|
| CAS Number | 884507-55-5 | Molecular Weight | 247.37900 | |
| Density | 1.004g/cm3 | Boiling Point | 342.9ºC at 760 mmHg | |
| Molecular Formula | C15H25N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.7ºC | |
| Name | N-methyl-1-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methanamine |
|---|
| Density | 1.004g/cm3 |
|---|---|
| Boiling Point | 342.9ºC at 760 mmHg |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.37900 |
| Flash Point | 159.7ºC |
| Exact Mass | 247.20500 |
| PSA | 18.51000 |
| LogP | 1.81020 |
| Index of Refraction | 1.539 |
| InChIKey | IAMOTCGZNDFBJW-UHFFFAOYSA-N |
| SMILES | CNCc1ccc(CN2CCCN(C)CC2)cc1 |
| Hazard Codes | C: Corrosive; |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |