[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methanamine structure
|
Common Name | [4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methanamine | ||
|---|---|---|---|---|
| CAS Number | 884507-52-2 | Molecular Weight | 233.35300 | |
| Density | 1.038g/cm3 | Boiling Point | 347.4ºC at 760 mmHg | |
| Molecular Formula | C14H23N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.6ºC | |
| Name | [4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.038g/cm3 |
|---|---|
| Boiling Point | 347.4ºC at 760 mmHg |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.35300 |
| Flash Point | 161.6ºC |
| Exact Mass | 233.18900 |
| PSA | 32.50000 |
| LogP | 1.85890 |
| Index of Refraction | 1.559 |
| InChIKey | AQLZGQUKWNQYPH-UHFFFAOYSA-N |
| SMILES | CN1CCCN(Cc2ccc(CN)cc2)CC1 |
| Hazard Codes | C: Corrosive; |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-[(4-Methylperhydro-1,4-diazepin-1-yl)methyl]benzylamine |
| {4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl}methanamine |