3-chloro-2-(2,4-dichlorophenyl)indazole structure
|
Common Name | 3-chloro-2-(2,4-dichlorophenyl)indazole | ||
|---|---|---|---|---|
| CAS Number | 88279-17-8 | Molecular Weight | 297.56700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H7Cl3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-chloro-2-(2,4-dichlorophenyl)indazole |
|---|
| Molecular Formula | C13H7Cl3N2 |
|---|---|
| Molecular Weight | 297.56700 |
| Exact Mass | 295.96700 |
| PSA | 17.82000 |
| LogP | 4.98570 |
| InChIKey | MNGSOJNEMWQUEN-UHFFFAOYSA-N |
| SMILES | Clc1ccc(-n2nc3ccccc3c2Cl)c(Cl)c1 |
|
~%
3-chloro-2-(2,4... CAS#:88279-17-8 |
| Literature: Ardakani, Manouchehr Azadi; Smalley, Robert K.; Smith, Richard H. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2501 - 2506 |
|
~%
3-chloro-2-(2,4... CAS#:88279-17-8 |
| Literature: Ardakani, Manouchehr Azadi; Smalley, Robert K.; Smith, Richard H. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2501 - 2506 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |