1-nitro-3-[tris(2-fluoro-2,2-dinitroethoxy)methyl]imidazolidin-2-one
Modify Date: 2025-08-23 19:21:51
![1-nitro-3-[tris(2-fluoro-2,2-dinitroethoxy)methyl]imidazolidin-2-one Structure](https://image.chemsrc.com/caspic/495/88262-51-5.png)
1-nitro-3-[tris(2-fluoro-2,2-dinitroethoxy)methyl]imidazolidin-2-one structure
|
Common Name | 1-nitro-3-[tris(2-fluoro-2,2-dinitroethoxy)methyl]imidazolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 88262-51-5 | Molecular Weight | 601.23100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10F3N9O18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-nitro-3-[tris(2-fluoro-2,2-dinitroethoxy)methyl]imidazolidin-2-one |
|---|
| Molecular Formula | C10H10F3N9O18 |
|---|---|
| Molecular Weight | 601.23100 |
| Exact Mass | 601.01000 |
| PSA | 371.98000 |
| LogP | 1.64510 |
| InChIKey | QMGVIYTZKRVVNQ-UHFFFAOYSA-N |
| SMILES | O=C1N([N+](=O)[O-])CCN1C(OCC(F)([N+](=O)[O-])[N+](=O)[O-])(OCC(F)([N+](=O)[O-])[N+](=O)[O-])OCC(F)([N+](=O)[O-])[N+](=O)[O-] |
|
~%
1-nitro-3-[tris... CAS#:88262-51-5 |
| Literature: The United States of America as represented by the Secretary of the Navy Patent: US4499309 A1, 1985 ; |
![1-[tris(2-fluoro-2,2-dinitroethoxy)methyl]imidazolidin-2-one structure](https://image.chemsrc.com/caspic/033/88262-50-4.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |