1-[tris(2-fluoro-2,2-dinitroethoxy)methyl]imidazolidin-2-one structure
|
Common Name | 1-[tris(2-fluoro-2,2-dinitroethoxy)methyl]imidazolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 88262-50-4 | Molecular Weight | 556.23400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11F3N8O16 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[tris(2-fluoro-2,2-dinitroethoxy)methyl]imidazolidin-2-one |
|---|
| Molecular Formula | C10H11F3N8O16 |
|---|---|
| Molecular Weight | 556.23400 |
| Exact Mass | 556.02500 |
| PSA | 338.44000 |
| LogP | 0.91990 |
| InChIKey | OKQBYKONACXKTO-UHFFFAOYSA-N |
| SMILES | O=C1NCCN1C(OCC(F)([N+](=O)[O-])[N+](=O)[O-])(OCC(F)([N+](=O)[O-])[N+](=O)[O-])OCC(F)([N+](=O)[O-])[N+](=O)[O-] |
|
~%
1-[tris(2-fluor... CAS#:88262-50-4 |
| Literature: The United States of America as represented by the Secretary of the Navy Patent: US4499309 A1, 1985 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |