2-ethylhexyl 3-[dichloro-[3-(2-ethylhexoxy)-3-oxopropyl]stannyl]propanoate
Modify Date: 2025-08-26 19:22:38
![2-ethylhexyl 3-[dichloro-[3-(2-ethylhexoxy)-3-oxopropyl]stannyl]propanoate Structure](https://image.chemsrc.com/caspic/389/88261-94-3.png)
2-ethylhexyl 3-[dichloro-[3-(2-ethylhexoxy)-3-oxopropyl]stannyl]propanoate structure
|
Common Name | 2-ethylhexyl 3-[dichloro-[3-(2-ethylhexoxy)-3-oxopropyl]stannyl]propanoate | ||
|---|---|---|---|---|
| CAS Number | 88261-94-3 | Molecular Weight | 560.17300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H42Cl2O4Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-ethylhexyl 3-[dichloro-[3-(2-ethylhexoxy)-3-oxopropyl]stannyl]propanoate |
|---|
| Molecular Formula | C22H42Cl2O4Sn |
|---|---|
| Molecular Weight | 560.17300 |
| Exact Mass | 560.14800 |
| PSA | 52.60000 |
| InChIKey | WLHZBAQMAOZFMX-UHFFFAOYSA-L |
| SMILES | CCCCC(CC)COC(=O)CC[Sn](Cl)(Cl)CCC(=O)OCC(CC)CCCC |
|
~98%
2-ethylhexyl 3-... CAS#:88261-94-3 |
| Literature: Cheng, Hong-Shing; Hwang, Tsai-Lih; Liu, Chao-Shiuan Journal of Organometallic Chemistry, 1983 , vol. 254, # 1 p. 43 - 52 |
|
~85%
2-ethylhexyl 3-... CAS#:88261-94-3 |
| Literature: Cheng, Hong-Shing; Hwang, Tsai-Lih; Liu, Chao-Shiuan Journal of Organometallic Chemistry, 1983 , vol. 254, # 1 p. 43 - 52 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |