iGOT1-01
Modify Date: 2025-11-24 18:08:41
iGOT1-01 structure
|
Common Name | iGOT1-01 | ||
|---|---|---|---|---|
| CAS Number | 882256-55-5 | Molecular Weight | 320.38800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H20N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of iGOT1-01iGOT1-01 is a small molecule inhibitor of aspartate aminotransferase 1 (glutamate oxaloacetate transaminase 1 (GOT1)) with IC50 of 11.3 uM. |
| Name | 1-Piperazinecarboxamide, 4-(1H-indol-4-yl)-N-phenyl |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H20N4O |
|---|---|
| Molecular Weight | 320.38800 |
| Exact Mass | 320.16400 |
| PSA | 51.37000 |
| LogP | 3.59790 |
| InChIKey | MGSDOEMLWKEWSV-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1)N1CCN(c2cccc3[nH]ccc23)CC1 |
| 1-piperazinecarboxamide, 4-(1h-indol-4-yl)-n-phenyl- |