N,N-bis(trimethylsilyl)but-3-en-1-amine structure
|
Common Name | N,N-bis(trimethylsilyl)but-3-en-1-amine | ||
|---|---|---|---|---|
| CAS Number | 88211-46-5 | Molecular Weight | 215.48300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H25NSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N-bis(trimethylsilyl)but-3-en-1-amine |
|---|
| Molecular Formula | C10H25NSi2 |
|---|---|
| Molecular Weight | 215.48300 |
| Exact Mass | 215.15300 |
| PSA | 3.24000 |
| LogP | 3.53430 |
| InChIKey | HOGVAPNZMCIHFT-UHFFFAOYSA-N |
| SMILES | C=CCCN([Si](C)(C)C)[Si](C)(C)C |
|
~78%
N,N-bis(trimeth... CAS#:88211-46-5 |
| Literature: Betsmann, Hans Juergen; Woelfel, Gerhard; Mederer, Karl Synthesis, 1987 , # 9 p. 848 - 850 |
|
~%
N,N-bis(trimeth... CAS#:88211-46-5 |
| Literature: Morimoto, Toshiaki; Takahashi, Toshio; Sekiya, Minoru Journal of the Chemical Society, Chemical Communications, 1984 , # 12 p. 794 - 795 |
|
~%
N,N-bis(trimeth... CAS#:88211-46-5 |
| Literature: Betsmann, Hans Juergen; Woelfel, Gerhard; Mederer, Karl Synthesis, 1987 , # 9 p. 848 - 850 |