Notoptol structure
|
Common Name | Notoptol | ||
|---|---|---|---|---|
| CAS Number | 88206-49-9 | Molecular Weight | 354.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of NotoptolNotoptol can be isolated from the fruit of Peucedanum alsaticum L[1]. |
| Name | 5-(7-hydroxy-3,7-dimethylocta-2,5-dienyloxy)psoralen |
|---|---|
| Synonym | More Synonyms |
| Description | Notoptol can be isolated from the fruit of Peucedanum alsaticum L[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C21H22O5 |
|---|---|
| Molecular Weight | 354.40 |
| Exact Mass | 354.14700 |
| PSA | 72.81000 |
| LogP | 4.58150 |
| InChIKey | WIEGIEBFVOUTDV-OVXNXNIRSA-N |
| SMILES | CC(=CCOc1c2ccoc2cc2oc(=O)ccc12)CC=CC(C)(C)O |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| notoptol |