isopyrazam
Modify Date: 2025-08-27 10:35:20
isopyrazam structure
|
Common Name | isopyrazam | ||
|---|---|---|---|---|
| CAS Number | 881685-58-1 | Molecular Weight | 359.41300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H23F2N3O | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS08, GHS09 |
Signal Word | Warning | |
| Name | isopyrazam |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H23F2N3O |
|---|---|
| Molecular Weight | 359.41300 |
| Exact Mass | 359.18100 |
| PSA | 46.92000 |
| LogP | 4.92980 |
| InChIKey | XTDZGXBTXBEZDN-UHFFFAOYSA-N |
| SMILES | CC(C)C1C2CCC1c1c(NC(=O)c3cn(C)nc3C(F)F)cccc12 |
| Symbol |
GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H317-H351-H361-H410 |
| Precautionary Statements | P273-P280-P501 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn,N |
| Risk Phrases | 63-40-43-50/53 |
| Safety Phrases | 36/37-60-61 |
| RIDADR | UN 3077 9 / PGIII |
|
Trace analysis of three fungicides in animal origin foods with a modified QuEChERS method and liquid chromatography-tandem mass spectrometry.
Anal. Bioanal. Chem 408 , 1515-22, (2016) A multi-residue method based on modified QuEChERS (quick, easy, cheap, effective, rugged, and safe) sample preparation, followed by liquid chromatography tandem mass spectrometry (LC-MS/MS), was devel... |
| rac-3-(difluoromethyl)-1-methyl-N-[(1R,4S,9RS)-9-(propan-2-yl)-1,2,3,4-tetrahydro-1,4-methanonaphthalen-5-yl]-1H-pyrazole-4-carboxamide |
| 1RS,4SR,9SR)-1,2,3,4-tetrahydro-9-isopropyl-1,4-methanonaphthalen-5-yl]pyrazole-4-carboxamide |
| 3-(difluoromethyl)-1-methyl-N-[1,2,3,4-tetrahydro-9-(1-methylethyl)-1,4-methanonaphthalen-5-yl]-1H-pyrazole-4-carboxamide |
| 3-(difluoromethyl)-1-methyl-N-[(1RS,4SR,9RS |
| ISOPYRAZAM PESTANAL |