7,9-dibromo-2,5-bis(1-pyrrolidino)-1,3,4,6,9b-pentaazaphenalene structure
|
Common Name | 7,9-dibromo-2,5-bis(1-pyrrolidino)-1,3,4,6,9b-pentaazaphenalene | ||
|---|---|---|---|---|
| CAS Number | 88061-91-0 | Molecular Weight | 467.16100 | |
| Density | 2.08g/cm3 | Boiling Point | 447.4ºC at 760 mmHg | |
| Molecular Formula | C16H17Br2N7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.4ºC | |
| Name | 7,9-dibromo-2,5-bis(1-pyrrolidino)-1,3,4,6,9b-pentaazaphenalene |
|---|
| Density | 2.08g/cm3 |
|---|---|
| Boiling Point | 447.4ºC at 760 mmHg |
| Molecular Formula | C16H17Br2N7 |
| Molecular Weight | 467.16100 |
| Flash Point | 224.4ºC |
| Exact Mass | 464.99100 |
| PSA | 62.45000 |
| LogP | 3.52790 |
| Index of Refraction | 1.882 |
| InChIKey | FYCBMTXPBWVQKR-UHFFFAOYSA-N |
| SMILES | BrC1=CC(Br)=C2N=C(N3CCCC3)N=C3N=C(N4CCCC4)N=C1N32 |
|
~50%
7,9-dibromo-2,5... CAS#:88061-91-0 |
| Literature: Shaw, John T.; Starkey, Kenneth D.; Pelliccione, David J.; Barnhart, Sharon L. Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 1095 - 1098 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |