7,9-dibromo-2-tribromomethyl-5-trichloromethyl-1,3,4,6,9b-pentaazaphenalene structure
|
Common Name | 7,9-dibromo-2-tribromomethyl-5-trichloromethyl-1,3,4,6,9b-pentaazaphenalene | ||
|---|---|---|---|---|
| CAS Number | 88061-88-5 | Molecular Weight | 697.02700 | |
| Density | 2.91g/cm3 | Boiling Point | 420.1ºC at 760 mmHg | |
| Molecular Formula | C10HBr5Cl3N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.9ºC | |
| Name | 7,9-dibromo-2-tribromomethyl-5-trichloromethyl-1,3,4,6,9b-pentaazaphenalene |
|---|
| Density | 2.91g/cm3 |
|---|---|
| Boiling Point | 420.1ºC at 760 mmHg |
| Molecular Formula | C10HBr5Cl3N5 |
| Molecular Weight | 697.02700 |
| Flash Point | 207.9ºC |
| Exact Mass | 690.52100 |
| PSA | 55.97000 |
| LogP | 6.31920 |
| Index of Refraction | 1.882 |
| InChIKey | CSOJPZVJOXMBOY-UHFFFAOYSA-N |
| SMILES | ClC(Cl)(Cl)C1=NC2=C(Br)C=C(Br)C3=NC(C(Br)(Br)Br)=NC(=N1)N32 |
|
~74%
7,9-dibromo-2-t... CAS#:88061-88-5 |
| Literature: Shaw, John T.; Starkey, Kenneth D.; Pelliccione, David J.; Barnhart, Sharon L. Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 1095 - 1098 |